C24H27N5O2 — CID 94837380
N'-[(E)-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide (PubChem CID 94837380) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N'-[(E)-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide.
| Compound Name | N'-[(E)-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 94837380 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N'-[(E)-[1-(2,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide |
| SMILES | Cc1ccc(C)c(-n2c(C)cc(/C=N/NC(=O)CC(=O)NCc3cccnc3)c2C)c1 |
| InChI | InChI=1S/C24H27N5O2/c1-16-7-8-17(2)22(10-16)29-18(3)11-21(19(29)4)15-27-28-24(31)12-23(30)26-14-20-6-5-9-25-13-20/h5-11,13,15H,12,14H2,1-4H3,(H,26,30)(H,28,31)/b27-15+ |
| InChIKey | BBUHYQOXIGOOCP-JFLMPSFJSA-N |
| XLogP | 3.26 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|