C17H15BrN4O4 — CID 4252330
N'-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide (PubChem CID 4252330) has the molecular formula C17H15BrN4O4 and a molecular weight of 419.24 g/mol. Its IUPAC name is N'-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide.
| Compound Name | N'-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 4252330 |
| Molecular Formula | C17H15BrN4O4 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N'-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide |
| SMILES | O=C(CC(=O)NN=Cc1cc2c(cc1Br)OCO2)NCc1cccnc1 |
| InChI | InChI=1S/C17H15BrN4O4/c18-13-5-15-14(25-10-26-15)4-12(13)9-21-22-17(24)6-16(23)20-8-11-2-1-3-19-7-11/h1-5,7,9H,6,8,10H2,(H,20,23)(H,22,24) |
| InChIKey | QZXSXVXSCUBWRI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|