C22H22BrN5O2 — CID 126002051
N'-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide (PubChem CID 126002051) has the molecular formula C22H22BrN5O2 and a molecular weight of 468.36 g/mol. Its IUPAC name is N'-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide.
| Compound Name | N'-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 126002051 |
| Molecular Formula | C22H22BrN5O2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N'-[(E)-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(pyridin-3-ylmethyl)propanediamide |
| SMILES | Cc1cc(/C=N/NC(=O)CC(=O)NCc2cccnc2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H22BrN5O2/c1-15-10-18(16(2)28(15)20-7-5-19(23)6-8-20)14-26-27-22(30)11-21(29)25-13-17-4-3-9-24-12-17/h3-10,12,14H,11,13H2,1-2H3,(H,25,29)(H,27,30)/b26-14+ |
| InChIKey | CPGKHOGZWRNHJZ-VULFUBBASA-N |
| XLogP | 3.41 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|