C7H9N2O3S- — CID 9484229
(2R)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoate (PubChem CID 9484229) has the molecular formula C7H9N2O3S- and a molecular weight of 201.23 g/mol. Its IUPAC name is (2R)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoate.
| Compound Name | (2R)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 9484229 |
| Molecular Formula | C7H9N2O3S- |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | (2R)-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanoate |
| SMILES | CCc1nnc(S[C@H](C)C(=O)[O-])o1 |
| InChI | InChI=1S/C7H10N2O3S/c1-3-5-8-9-7(12-5)13-4(2)6(10)11/h4H,3H2,1-2H3,(H,10,11)/p-1/t4-/m1/s1 |
| InChIKey | ACZYJNCJQSTKHQ-SCSAIBSYSA-M |
| XLogP | -0.14 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |