C21H26N2OS — CID 94842488
N-[(2S)-2-ethylhexyl]phenothiazine-10-carboxamide (PubChem CID 94842488) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is N-[(2S)-2-ethylhexyl]phenothiazine-10-carboxamide.
| Compound Name | N-[(2S)-2-ethylhexyl]phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 94842488 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[(2S)-2-ethylhexyl]phenothiazine-10-carboxamide |
| SMILES | CCCC[C@H](CC)CNC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C21H26N2OS/c1-3-5-10-16(4-2)15-22-21(24)23-17-11-6-8-13-19(17)25-20-14-9-7-12-18(20)23/h6-9,11-14,16H,3-5,10,15H2,1-2H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | WUOGRXLJYPHJPG-INIZCTEOSA-N |
| XLogP | 6.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |