C19H16BrN3O6 — CID 94846386
ethyl 4-[[2-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate (PubChem CID 94846386) has the molecular formula C19H16BrN3O6 and a molecular weight of 462.26 g/mol. Its IUPAC name is ethyl 4-[[2-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 94846386 |
| Molecular Formula | C19H16BrN3O6 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | ethyl 4-[[2-[(2Z)-2-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)N/N=C\c2cc3c(cc2Br)OCO3)cc1 |
| InChI | InChI=1S/C19H16BrN3O6/c1-2-27-19(26)11-3-5-13(6-4-11)22-17(24)18(25)23-21-9-12-7-15-16(8-14(12)20)29-10-28-15/h3-9H,2,10H2,1H3,(H,22,24)(H,23,25)/b21-9- |
| InChIKey | DPDYCDFKVKHQCM-NKVSQWTQSA-N |
| XLogP | 2.44 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|