C33H30N2O6 — CID 94850551
(3S,4R)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 94850551) has the molecular formula C33H30N2O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is (3S,4R)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4R)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 94850551 |
| Molecular Formula | C33H30N2O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | (3S,4R)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,3-bis(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | COc1ccc([C@@H]2[C@H](C(=O)NC[C@@H]3COc4ccccc4O3)c3ccccc3C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H30N2O6/c1-38-23-15-11-21(12-16-23)31-30(32(36)34-19-25-20-40-28-9-5-6-10-29(28)41-25)26-7-3-4-8-27(26)33(37)35(31)22-13-17-24(39-2)18-14-22/h3-18,25,30-31H,19-20H2,1-2H3,(H,34,36)/t25-,30-,31-/m1/s1 |
| InChIKey | XZQRFLPYPJNURK-KVXGTOJUSA-N |
| XLogP | 5.15 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |