C31H34N2O8 — CID 98186492
(2S,3S)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(4-methoxyphenyl)-6-oxo-1-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide (PubChem CID 98186492) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is (2S,3S)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(4-methoxyphenyl)-6-oxo-1-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide.
| Compound Name | (2S,3S)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(4-methoxyphenyl)-6-oxo-1-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 98186492 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (2S,3S)-N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2-(4-methoxyphenyl)-6-oxo-1-(3,4,5-trimethoxyphenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)NC[C@@H]3COc4ccccc4O3)CCC(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H34N2O8/c1-36-21-11-9-19(10-12-21)29-23(31(35)32-17-22-18-40-24-7-5-6-8-25(24)41-22)13-14-28(34)33(29)20-15-26(37-2)30(39-4)27(16-20)38-3/h5-12,15-16,22-23,29H,13-14,17-18H2,1-4H3,(H,32,35)/t22-,23+,29-/m1/s1 |
| InChIKey | SUVQCMZTIUUWAZ-RLPNJSHFSA-N |
| XLogP | 4.16 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |