About (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide
(2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide (PubChem CID 94865204) has the molecular formula C18H25N3O
and a molecular weight of 299.42 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide.
Molecular Properties
| Compound Name | (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide |
| PubChem CID | 94865204 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide |
| SMILES | CCCc1cn([C@@H](CC)C(=O)N(C)C)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H25N3O/c1-5-10-15-13-21(16(6-2)18(22)20(3)4)19-17(15)14-11-8-7-9-12-14/h7-9,11-13,16H,5-6,10H2,1-4H3/t16-/m0/s1 |
| InChIKey | CEXKXWXRDRVIMG-INIZCTEOSA-N |
| XLogP | 3.54 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide?
The IUPAC name of (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide (CID 94865204) is (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide.
What is the SMILES notation for (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide?
The canonical SMILES for (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide is CCCc1cn([C@@H](CC)C(=O)N(C)C)nc1-c1ccccc1.
What is the InChIKey of (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide?
The InChIKey is CEXKXWXRDRVIMG-INIZCTEOSA-N. The full InChI is InChI=1S/C18H25N3O/c1-5-10-15-13-21(16(6-2)18(22)20(3)4)19-17(15)14-11-8-7-9-12-14/h7-9,11-13,16H,5-6,10H2,1-4H3/t16-/m0/s1.
What are the key properties of (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide?
(2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide has a molecular weight of 299.42 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dimethyl-2-(3-phenyl-4-propylpyrazol-1-yl)butanamide is sourced from PubChem (CID 94865204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).