C17H16ClF3N3O2+ — CID 9490096
N-[2-chloro-4-(trifluoromethyl)phenyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide (PubChem CID 9490096) has the molecular formula C17H16ClF3N3O2+ and a molecular weight of 386.78 g/mol. Its IUPAC name is N-[2-chloro-4-(trifluoromethyl)phenyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 9490096 |
| Molecular Formula | C17H16ClF3N3O2+ |
| Molecular Weight | 386.78 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-4-morpholin-4-ylpyridin-1-ium-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1Cl)c1cc(N2CCOCC2)cc[nH+]1 |
| InChI | InChI=1S/C17H15ClF3N3O2/c18-13-9-11(17(19,20)21)1-2-14(13)23-16(25)15-10-12(3-4-22-15)24-5-7-26-8-6-24/h1-4,9-10H,5-8H2,(H,23,25)/p+1 |
| InChIKey | PNWXHDNQIDIGTR-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |