C16H20FN3O4S2 — CID 9490211
2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 9490211) has the molecular formula C16H20FN3O4S2 and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 9490211 |
| Molecular Formula | C16H20FN3O4S2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCC(=O)NCCSCc1ccccc1F |
| InChI | InChI=1S/C16H20FN3O4S2/c1-11-16(12(2)24-20-11)26(22,23)19-9-15(21)18-7-8-25-10-13-5-3-4-6-14(13)17/h3-6,19H,7-10H2,1-2H3,(H,18,21) |
| InChIKey | FGZDGWIVTOSDSS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|