C21H23N3O2S — CID 9490303
(3aS)-N-(2-benzylsulfanylethyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxamide (PubChem CID 9490303) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is (3aS)-N-(2-benzylsulfanylethyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxamide.
| Compound Name | (3aS)-N-(2-benzylsulfanylethyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxamide |
|---|---|
| PubChem CID | 9490303 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (3aS)-N-(2-benzylsulfanylethyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoxaline-7-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1)c1ccc2c(c1)NC(=O)[C@@H]1CCCN21 |
| InChI | InChI=1S/C21H23N3O2S/c25-20(22-10-12-27-14-15-5-2-1-3-6-15)16-8-9-18-17(13-16)23-21(26)19-7-4-11-24(18)19/h1-3,5-6,8-9,13,19H,4,7,10-12,14H2,(H,22,25)(H,23,26)/t19-/m0/s1 |
| InChIKey | AIMSLSKPIRVYPG-IBGZPJMESA-N |
| XLogP | 3.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|