C14H10FN3O4S — CID 9492617
(2R)-4-(5-fluoro-2-nitrophenoxy)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile (PubChem CID 9492617) has the molecular formula C14H10FN3O4S and a molecular weight of 335.32 g/mol. Its IUPAC name is (2R)-4-(5-fluoro-2-nitrophenoxy)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile.
| Compound Name | (2R)-4-(5-fluoro-2-nitrophenoxy)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 9492617 |
| Molecular Formula | C14H10FN3O4S |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (2R)-4-(5-fluoro-2-nitrophenoxy)-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile |
| SMILES | Cc1csc([C@H](C#N)C(=O)COc2cc(F)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H10FN3O4S/c1-8-7-23-14(17-8)10(5-16)12(19)6-22-13-4-9(15)2-3-11(13)18(20)21/h2-4,7,10H,6H2,1H3/t10-/m1/s1 |
| InChIKey | CETUOZMBVFTKDX-SNVBAGLBSA-N |
| XLogP | 2.75 |
| TPSA | 106.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|