C16H19ClN2O4 — CID 949324
3-(2-chlorophenyl)-N-(2,2-dimethoxyethyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 949324) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(2,2-dimethoxyethyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-(2,2-dimethoxyethyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 949324 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(2,2-dimethoxyethyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | COC(CN(C)C(=O)c1c(-c2ccccc2Cl)noc1C)OC |
| InChI | InChI=1S/C16H19ClN2O4/c1-10-14(16(20)19(2)9-13(21-3)22-4)15(18-23-10)11-7-5-6-8-12(11)17/h5-8,13H,9H2,1-4H3 |
| InChIKey | UCKGJMUSDOYGAU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|