C17H19N3O3 — CID 94935933
2-[4-(5-cyclohexyl-4-formyltriazol-1-yl)phenyl]acetic acid (PubChem CID 94935933) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[4-(5-cyclohexyl-4-formyltriazol-1-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(5-cyclohexyl-4-formyltriazol-1-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 94935933 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[4-(5-cyclohexyl-4-formyltriazol-1-yl)phenyl]acetic acid |
| SMILES | O=Cc1nnn(-c2ccc(CC(=O)O)cc2)c1C1CCCCC1 |
| InChI | InChI=1S/C17H19N3O3/c21-11-15-17(13-4-2-1-3-5-13)20(19-18-15)14-8-6-12(7-9-14)10-16(22)23/h6-9,11,13H,1-5,10H2,(H,22,23) |
| InChIKey | OYMGEOJNWNIKPF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|