C17H21N3O3 — CID 94938164
5-cyclohexyl-1-(2,4-dimethoxyphenyl)triazole-4-carbaldehyde (PubChem CID 94938164) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-cyclohexyl-1-(2,4-dimethoxyphenyl)triazole-4-carbaldehyde.
| Compound Name | 5-cyclohexyl-1-(2,4-dimethoxyphenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94938164 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-cyclohexyl-1-(2,4-dimethoxyphenyl)triazole-4-carbaldehyde |
| SMILES | COc1ccc(-n2nnc(C=O)c2C2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H21N3O3/c1-22-13-8-9-15(16(10-13)23-2)20-17(14(11-21)18-19-20)12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3 |
| InChIKey | DXQJUHVZFPPYTP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|