C15H17N3O4 — CID 82197895
1-(2,4-dimethoxyphenyl)-5-(oxolan-2-yl)triazole-4-carbaldehyde (PubChem CID 82197895) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5-(oxolan-2-yl)triazole-4-carbaldehyde.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5-(oxolan-2-yl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82197895 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5-(oxolan-2-yl)triazole-4-carbaldehyde |
| SMILES | COc1ccc(-n2nnc(C=O)c2C2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-20-10-5-6-12(14(8-10)21-2)18-15(11(9-19)16-17-18)13-4-3-7-22-13/h5-6,8-9,13H,3-4,7H2,1-2H3 |
| InChIKey | YXRKZAXHPRINIL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|