C17H26N2O3S — CID 949390
(2S,6S)-4-[1-(benzenesulfonyl)piperidin-4-yl]-2,6-dimethylmorpholine (PubChem CID 949390) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is (2S,6S)-4-[1-(benzenesulfonyl)piperidin-4-yl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-[1-(benzenesulfonyl)piperidin-4-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 949390 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2S,6S)-4-[1-(benzenesulfonyl)piperidin-4-yl]-2,6-dimethylmorpholine |
| SMILES | C[C@H]1CN(C2CCN(S(=O)(=O)c3ccccc3)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H26N2O3S/c1-14-12-18(13-15(2)22-14)16-8-10-19(11-9-16)23(20,21)17-6-4-3-5-7-17/h3-7,14-16H,8-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | WSDALVGVMYXOLO-GJZGRUSLSA-N |
| XLogP | 1.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |