C14H14F3N3O2 — CID 94940294
5-(2-methylpropyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid (PubChem CID 94940294) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-methylpropyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94940294 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-(2-methylpropyl)-1-[3-(trifluoromethyl)phenyl]triazole-4-carboxylic acid |
| SMILES | CC(C)Cc1c(C(=O)O)nnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3N3O2/c1-8(2)6-11-12(13(21)22)18-19-20(11)10-5-3-4-9(7-10)14(15,16)17/h3-5,7-8H,6H2,1-2H3,(H,21,22) |
| InChIKey | NPQVLMYMUHJBMM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |