C17H22N4O2 — CID 94940297
5-(2-methylpropyl)-1-(4-pyrrolidin-1-ylphenyl)triazole-4-carboxylic acid (PubChem CID 94940297) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1-(4-pyrrolidin-1-ylphenyl)triazole-4-carboxylic acid.
| Compound Name | 5-(2-methylpropyl)-1-(4-pyrrolidin-1-ylphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94940297 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-(2-methylpropyl)-1-(4-pyrrolidin-1-ylphenyl)triazole-4-carboxylic acid |
| SMILES | CC(C)Cc1c(C(=O)O)nnn1-c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C17H22N4O2/c1-12(2)11-15-16(17(22)23)18-19-21(15)14-7-5-13(6-8-14)20-9-3-4-10-20/h5-8,12H,3-4,9-11H2,1-2H3,(H,22,23) |
| InChIKey | MZEOTCGLQRTTLG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|