C17H23N3O3 — CID 94940298
1-[4-(2-methylpropoxy)phenyl]-5-(2-methylpropyl)triazole-4-carboxylic acid (PubChem CID 94940298) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[4-(2-methylpropoxy)phenyl]-5-(2-methylpropyl)triazole-4-carboxylic acid.
| Compound Name | 1-[4-(2-methylpropoxy)phenyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94940298 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[4-(2-methylpropoxy)phenyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
| SMILES | CC(C)COc1ccc(-n2nnc(C(=O)O)c2CC(C)C)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-11(2)9-15-16(17(21)22)18-19-20(15)13-5-7-14(8-6-13)23-10-12(3)4/h5-8,11-12H,9-10H2,1-4H3,(H,21,22) |
| InChIKey | RTBXVWQZSYRAMP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |