C25H23ClN2O6 — CID 94962223
(7-acetamido-2-oxochromen-4-yl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate (PubChem CID 94962223) has the molecular formula C25H23ClN2O6 and a molecular weight of 482.92 g/mol. Its IUPAC name is (7-acetamido-2-oxochromen-4-yl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate.
| Compound Name | (7-acetamido-2-oxochromen-4-yl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 94962223 |
| Molecular Formula | C25H23ClN2O6 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | (7-acetamido-2-oxochromen-4-yl)methyl (3R)-1-(4-chlorobenzoyl)piperidine-3-carboxylate |
| SMILES | CC(=O)Nc1ccc2c(COC(=O)[C@@H]3CCCN(C(=O)c4ccc(Cl)cc4)C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H23ClN2O6/c1-15(29)27-20-8-9-21-18(11-23(30)34-22(21)12-20)14-33-25(32)17-3-2-10-28(13-17)24(31)16-4-6-19(26)7-5-16/h4-9,11-12,17H,2-3,10,13-14H2,1H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | JMJQAOBNGDMXDK-QGZVFWFLSA-N |
| XLogP | 4.00 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|