C23H21ClN2O4 — CID 94672087
(3R)-1-(4-chlorobenzoyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide (PubChem CID 94672087) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94672087 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@@H]3CCCN(C(=O)c4ccc(Cl)cc4)C3)ccc12 |
| InChI | InChI=1S/C23H21ClN2O4/c1-14-11-21(27)30-20-12-18(8-9-19(14)20)25-22(28)16-3-2-10-26(13-16)23(29)15-4-6-17(24)7-5-15/h4-9,11-12,16H,2-3,10,13H2,1H3,(H,25,28)/t16-/m1/s1 |
| InChIKey | XRECCEAHLRMDAS-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|