C16H14Cl2N2O — CID 94963899
6-chloro-3-(chloromethyl)-2-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridine (PubChem CID 94963899) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 6-chloro-3-(chloromethyl)-2-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-3-(chloromethyl)-2-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 94963899 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-2-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridine |
| SMILES | COc1ccc(Cc2nc3ccc(Cl)cn3c2CCl)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-21-13-5-2-11(3-6-13)8-14-15(9-17)20-10-12(18)4-7-16(20)19-14/h2-7,10H,8-9H2,1H3 |
| InChIKey | FDLAGHHXTCLMCD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|