C24H25ClF3N3O2S — CID 9498712
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-3-hexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 9498712) has the molecular formula C24H25ClF3N3O2S and a molecular weight of 512.00 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-3-hexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-3-hexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 9498712 |
| Molecular Formula | C24H25ClF3N3O2S |
| Molecular Weight | 512.00 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-3-hexyl-4-oxo-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCCCCCN1C(=O)[C@@H](CC(=O)Nc2cc(C(F)(F)F)ccc2Cl)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C24H25ClF3N3O2S/c1-2-3-4-8-13-31-22(33)20(34-23(31)29-17-9-6-5-7-10-17)15-21(32)30-19-14-16(24(26,27)28)11-12-18(19)25/h5-7,9-12,14,20H,2-4,8,13,15H2,1H3,(H,30,32)/b29-23-/t20-/m1/s1 |
| InChIKey | XFBFJGHZFLLGMK-SYYSWTDVSA-N |
| XLogP | 6.90 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.00 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|