C16H11F2N3OS — CID 950218
(E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 950218) has the molecular formula C16H11F2N3OS and a molecular weight of 331.35 g/mol. Its IUPAC name is (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 950218 |
| Molecular Formula | C16H11F2N3OS |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (E)-2-cyano-N-[4-(difluoromethylsulfanyl)phenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1cccnc1)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C16H11F2N3OS/c17-16(18)23-14-5-3-13(4-6-14)21-15(22)12(9-19)8-11-2-1-7-20-10-11/h1-8,10,16H,(H,21,22)/b12-8+ |
| InChIKey | OHAATDBKCHHTIB-XYOKQWHBSA-N |
| XLogP | 3.94 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|