C20H11F2NOS — CID 95041770
(Z)-2-(3,4-difluorobenzoyl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile (PubChem CID 95041770) has the molecular formula C20H11F2NOS and a molecular weight of 351.38 g/mol. Its IUPAC name is (Z)-2-(3,4-difluorobenzoyl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-difluorobenzoyl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 95041770 |
| Molecular Formula | C20H11F2NOS |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (Z)-2-(3,4-difluorobenzoyl)-3-(4-phenylthiophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(-c2ccccc2)cs1)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H11F2NOS/c21-18-7-6-14(10-19(18)22)20(24)15(11-23)8-17-9-16(12-25-17)13-4-2-1-3-5-13/h1-10,12H/b15-8- |
| InChIKey | NOPGJXQIVPRBMT-NVNXTCNLSA-N |
| XLogP | 5.48 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|