C23H19NO4S2 — CID 95061988
(7S)-3-(3-methylphenyl)sulfonyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 95061988) has the molecular formula C23H19NO4S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is (7S)-3-(3-methylphenyl)sulfonyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | (7S)-3-(3-methylphenyl)sulfonyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 95061988 |
| Molecular Formula | C23H19NO4S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (7S)-3-(3-methylphenyl)sulfonyl-7-(4-prop-2-ynoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C#CCOc1ccc([C@@H]2CC(=O)Nc3c(S(=O)(=O)c4cccc(C)c4)csc32)cc1 |
| InChI | InChI=1S/C23H19NO4S2/c1-3-11-28-17-9-7-16(8-10-17)19-13-21(25)24-22-20(14-29-23(19)22)30(26,27)18-6-4-5-15(2)12-18/h1,4-10,12,14,19H,11,13H2,2H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | ARADCHRPCOSISQ-IBGZPJMESA-N |
| XLogP | 4.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|