C12H12BrNO2S3 — CID 95064233
2-[(R)-(5-bromothiophen-3-yl)methylsulfinyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 95064233) has the molecular formula C12H12BrNO2S3 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-[(R)-(5-bromothiophen-3-yl)methylsulfinyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[(R)-(5-bromothiophen-3-yl)methylsulfinyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95064233 |
| Molecular Formula | C12H12BrNO2S3 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 376.92 |
| IUPAC Name | 2-[(R)-(5-bromothiophen-3-yl)methylsulfinyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(C[S@](=O)Cc1csc(Br)c1)NCc1cccs1 |
| InChI | InChI=1S/C12H12BrNO2S3/c13-11-4-9(6-18-11)7-19(16)8-12(15)14-5-10-2-1-3-17-10/h1-4,6H,5,7-8H2,(H,14,15)/t19-/m1/s1 |
| InChIKey | FWZJOHQDQHZWOO-LJQANCHMSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |