C20H29F3O4 — CID 95065613
(5R,6Z,8E,10E,12R,14Z)-20,20,20-trifluoro-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid (PubChem CID 95065613) has the molecular formula C20H29F3O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (5R,6Z,8E,10E,12R,14Z)-20,20,20-trifluoro-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid.
| Compound Name | (5R,6Z,8E,10E,12R,14Z)-20,20,20-trifluoro-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 95065613 |
| Molecular Formula | C20H29F3O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (5R,6Z,8E,10E,12R,14Z)-20,20,20-trifluoro-5,12-dihydroxyicosa-6,8,10,14-tetraenoic acid |
| SMILES | O=C(O)CCC[C@@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCC(F)(F)F |
| InChI | InChI=1S/C20H29F3O4/c21-20(22,23)16-9-5-1-2-6-11-17(24)12-7-3-4-8-13-18(25)14-10-15-19(26)27/h2-4,6-8,12-13,17-18,24-25H,1,5,9-11,14-16H2,(H,26,27)/b4-3+,6-2-,12-7+,13-8-/t17-,18+/m1/s1 |
| InChIKey | YKIRCSCMMMEEDI-AVHJZUJCSA-N |
| XLogP | 4.70 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|