C16H15NO5S — CID 95065960
(1R,2S,6S,7S)-4-(2-hydroxy-5-methylsulfonylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 95065960) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is (1R,2S,6S,7S)-4-(2-hydroxy-5-methylsulfonylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7S)-4-(2-hydroxy-5-methylsulfonylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 95065960 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (1R,2S,6S,7S)-4-(2-hydroxy-5-methylsulfonylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CS(=O)(=O)c1ccc(O)c(N2C(=O)[C@@H]3[C@@H](C2=O)[C@H]2C=C[C@@H]3C2)c1 |
| InChI | InChI=1S/C16H15NO5S/c1-23(21,22)10-4-5-12(18)11(7-10)17-15(19)13-8-2-3-9(6-8)14(13)16(17)20/h2-5,7-9,13-14,18H,6H2,1H3/t8-,9+,13-,14-/m0/s1 |
| InChIKey | PLGDJFUIASMHQM-WAYYCVMKSA-N |
| XLogP | 1.11 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|