About 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol
2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol (PubChem CID 118038325) has the molecular formula C30H29NO7S
and a molecular weight of 547.63 g/mol. Its IUPAC name is 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol.
Molecular Properties
| Compound Name | 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol |
| PubChem CID | 118038325 |
| Molecular Formula | C30H29NO7S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol |
| SMILES | COc1cccc(OC)c1C1c2c(OC)cccc2N(c2cc(S(C)(=O)=O)ccc2O)c2cccc(OC)c21 |
| InChI | InChI=1S/C30H29NO7S/c1-35-23-11-6-9-19-27(23)30(29-25(37-3)13-8-14-26(29)38-4)28-20(10-7-12-24(28)36-2)31(19)21-17-18(39(5,33)34)15-16-22(21)32/h6-17,30,32H,1-5H3 |
| InChIKey | DFNAQQPYFJLBET-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol?
The IUPAC name of 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol (CID 118038325) is 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol.
What is the SMILES notation for 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol?
The canonical SMILES for 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol is COc1cccc(OC)c1C1c2c(OC)cccc2N(c2cc(S(C)(=O)=O)ccc2O)c2cccc(OC)c21.
What is the InChIKey of 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol?
The InChIKey is DFNAQQPYFJLBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H29NO7S/c1-35-23-11-6-9-19-27(23)30(29-25(37-3)13-8-14-26(29)38-4)28-20(10-7-12-24(28)36-2)31(19)21-17-18(39(5,33)34)15-16-22(21)32/h6-17,30,32H,1-5H3.
What are the key properties of 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol?
2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol has a molecular weight of 547.63 g/mol, XLogP of 5.79, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-9H-acridin-10-yl]-4-methylsulfonylphenol is sourced from PubChem (CID 118038325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).