C25H21ClN2O8S — CID 98175040
dimethyl 5-[[4-chloro-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]sulfonylamino]benzene-1,3-dicarboxylate (PubChem CID 98175040) has the molecular formula C25H21ClN2O8S and a molecular weight of 544.97 g/mol. Its IUPAC name is dimethyl 5-[[4-chloro-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]sulfonylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-chloro-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]sulfonylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98175040 |
| Molecular Formula | C25H21ClN2O8S |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | dimethyl 5-[[4-chloro-3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]sulfonylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(Cl)c(N3C(=O)[C@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H21ClN2O8S/c1-35-24(31)14-8-15(25(32)36-2)10-16(9-14)27-37(33,34)17-5-6-18(26)19(11-17)28-22(29)20-12-3-4-13(7-12)21(20)23(28)30/h3-6,8-13,20-21,27H,7H2,1-2H3/t12-,13-,20+,21+/m0/s1 |
| InChIKey | SZBULODHCSDODM-SPDQCEQOSA-N |
| XLogP | 3.03 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|