C16H14FN3O3 — CID 95102464
(2R)-N-(2-fluorophenyl)-2,4-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide (PubChem CID 95102464) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2,4-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2,4-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 95102464 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2,4-dimethyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide |
| SMILES | CN1C(=O)[C@@](C)(C(=O)Nc2ccccc2F)Oc2cccnc21 |
| InChI | InChI=1S/C16H14FN3O3/c1-16(14(21)19-11-7-4-3-6-10(11)17)15(22)20(2)13-12(23-16)8-5-9-18-13/h3-9H,1-2H3,(H,19,21)/t16-/m1/s1 |
| InChIKey | AKNQFTGTDVWONE-MRXNPFEDSA-N |
| XLogP | 1.97 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|