C17H20N6O2 — CID 95108044
pyrazin-2-yl-[(3S)-3-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone (PubChem CID 95108044) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is pyrazin-2-yl-[(3S)-3-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone.
| Compound Name | pyrazin-2-yl-[(3S)-3-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95108044 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | pyrazin-2-yl-[(3S)-3-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cnccn1)N1CC[C@H](Oc2cc(N3CCCC3)ncn2)C1 |
| InChI | InChI=1S/C17H20N6O2/c24-17(14-10-18-4-5-19-14)23-8-3-13(11-23)25-16-9-15(20-12-21-16)22-6-1-2-7-22/h4-5,9-10,12-13H,1-3,6-8,11H2/t13-/m0/s1 |
| InChIKey | KXQRGIYIDPJEMC-ZDUSSCGKSA-N |
| XLogP | 1.16 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |