C18H22N6O2 — CID 95108089
[(3R)-3-(6-piperidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 95108089) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is [(3R)-3-(6-piperidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3R)-3-(6-piperidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 95108089 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [(3R)-3-(6-piperidin-1-ylpyrimidin-4-yl)oxypyrrolidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CC[C@@H](Oc2cc(N3CCCCC3)ncn2)C1 |
| InChI | InChI=1S/C18H22N6O2/c25-18(15-11-19-5-6-20-15)24-9-4-14(12-24)26-17-10-16(21-13-22-17)23-7-2-1-3-8-23/h5-6,10-11,13-14H,1-4,7-9,12H2/t14-/m1/s1 |
| InChIKey | UIJBNCUTTZUJOI-CQSZACIVSA-N |
| XLogP | 1.55 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |