C23H25N3O4 — CID 95113879
2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 95113879) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 95113879 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CNC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3cccc(C)c32)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-15-6-3-9-18-21(15)26(23(29)19-10-5-11-25(19)22(18)28)14-20(27)24-13-16-7-4-8-17(12-16)30-2/h3-4,6-9,12,19H,5,10-11,13-14H2,1-2H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | JAVCKUVPFKJNST-IBGZPJMESA-N |
| XLogP | 2.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |