C23H25N3O3 — CID 95113876
2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 95113876) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 95113876 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[(6aS)-4-methyl-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccccc1CNC(=O)CN1C(=O)[C@@H]2CCCN2C(=O)c2cccc(C)c21 |
| InChI | InChI=1S/C23H25N3O3/c1-15-7-3-4-9-17(15)13-24-20(27)14-26-21-16(2)8-5-10-18(21)22(28)25-12-6-11-19(25)23(26)29/h3-5,7-10,19H,6,11-14H2,1-2H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | AFHPPEXKFXHFDF-IBGZPJMESA-N |
| XLogP | 2.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |