C19H28N2O2 — CID 95122157
[(2R)-2-butyl-2,5-dihydropyrrol-1-yl]-[1-(furan-2-ylmethyl)piperidin-4-yl]methanone (PubChem CID 95122157) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(2R)-2-butyl-2,5-dihydropyrrol-1-yl]-[1-(furan-2-ylmethyl)piperidin-4-yl]methanone.
| Compound Name | [(2R)-2-butyl-2,5-dihydropyrrol-1-yl]-[1-(furan-2-ylmethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 95122157 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(2R)-2-butyl-2,5-dihydropyrrol-1-yl]-[1-(furan-2-ylmethyl)piperidin-4-yl]methanone |
| SMILES | CCCC[C@@H]1C=CCN1C(=O)C1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H28N2O2/c1-2-3-6-17-7-4-11-21(17)19(22)16-9-12-20(13-10-16)15-18-8-5-14-23-18/h4-5,7-8,14,16-17H,2-3,6,9-13,15H2,1H3/t17-/m1/s1 |
| InChIKey | HKBVWZVBXIXLPO-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|