C15H28N4O3S — CID 95126760
(3R)-N-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(methanesulfonamido)piperidine-1-carboxamide (PubChem CID 95126760) has the molecular formula C15H28N4O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is (3R)-N-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(methanesulfonamido)piperidine-1-carboxamide.
| Compound Name | (3R)-N-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(methanesulfonamido)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95126760 |
| Molecular Formula | C15H28N4O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3R)-N-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(methanesulfonamido)piperidine-1-carboxamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCCN(C(=O)N[C@H]2CCN3CCCC[C@H]23)C1 |
| InChI | InChI=1S/C15H28N4O3S/c1-23(21,22)17-12-5-4-9-19(11-12)15(20)16-13-7-10-18-8-3-2-6-14(13)18/h12-14,17H,2-11H2,1H3,(H,16,20)/t12-,13+,14-/m1/s1 |
| InChIKey | IVLGNGHHXOEQQN-HZSPNIEDSA-N |
| XLogP | 0.34 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |