C21H27N5O — CID 95132460
[(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-[4-(pyridin-4-ylmethylamino)phenyl]methanone (PubChem CID 95132460) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is [(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-[4-(pyridin-4-ylmethylamino)phenyl]methanone.
| Compound Name | [(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-[4-(pyridin-4-ylmethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 95132460 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [(9aS)-8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]-[4-(pyridin-4-ylmethylamino)phenyl]methanone |
| SMILES | CN1CCN2CCN(C(=O)c3ccc(NCc4ccncc4)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C21H27N5O/c1-24-10-11-25-12-13-26(16-20(25)15-24)21(27)18-2-4-19(5-3-18)23-14-17-6-8-22-9-7-17/h2-9,20,23H,10-16H2,1H3/t20-/m0/s1 |
| InChIKey | HZBQWECOOAUZII-FQEVSTJZSA-N |
| XLogP | 1.77 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |