C16H18N6O2 — CID 95136428
1-[(1R)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)ethanone (PubChem CID 95136428) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[(1R)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)ethanone.
| Compound Name | 1-[(1R)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)ethanone |
|---|---|
| PubChem CID | 95136428 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[(1R)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)ethanone |
| SMILES | Cc1ccc2n1CCN(C(=O)COc1ccc3nncn3n1)[C@@H]2C |
| InChI | InChI=1S/C16H18N6O2/c1-11-3-4-13-12(2)21(8-7-20(11)13)16(23)9-24-15-6-5-14-18-17-10-22(14)19-15/h3-6,10,12H,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | TXEGMPVUYJRIKQ-GFCCVEGCSA-N |
| XLogP | 1.22 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |