C18H18N2O3S — CID 95140674
3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanylmethyl]benzamide (PubChem CID 95140674) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanylmethyl]benzamide.
| Compound Name | 3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 95140674 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-nitro-4-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(CS[C@H]2CCCc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N2O3S/c19-18(21)13-8-9-14(16(10-13)20(22)23)11-24-17-7-3-5-12-4-1-2-6-15(12)17/h1-2,4,6,8-10,17H,3,5,7,11H2,(H2,19,21)/t17-/m0/s1 |
| InChIKey | CZKWEUMNOVDUSS-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|