C22H23N3O4S — CID 55592430
4-[2-[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 55592430) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-[2-[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 55592430 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[2-[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(SCC(=O)N(C2CC2)C2CCCc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23N3O4S/c23-22(27)15-8-11-20(19(12-15)25(28)29)30-13-21(26)24(16-9-10-16)18-7-3-5-14-4-1-2-6-17(14)18/h1-2,4,6,8,11-12,16,18H,3,5,7,9-10,13H2,(H2,23,27) |
| InChIKey | FXSKZLTVNZOCJQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|