C18H21FN2O2 — CID 951419
[(1R,2R)-2-(3,5-dimethylpyrazol-1-yl)cyclohexyl] 2-fluorobenzoate (PubChem CID 951419) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is [(1R,2R)-2-(3,5-dimethylpyrazol-1-yl)cyclohexyl] 2-fluorobenzoate.
| Compound Name | [(1R,2R)-2-(3,5-dimethylpyrazol-1-yl)cyclohexyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 951419 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [(1R,2R)-2-(3,5-dimethylpyrazol-1-yl)cyclohexyl] 2-fluorobenzoate |
| SMILES | Cc1cc(C)n([C@@H]2CCCC[C@H]2OC(=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C18H21FN2O2/c1-12-11-13(2)21(20-12)16-9-5-6-10-17(16)23-18(22)14-7-3-4-8-15(14)19/h3-4,7-8,11,16-17H,5-6,9-10H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | AUHRYULJCBPMPG-IAGOWNOFSA-N |
| XLogP | 3.98 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |