C17H22N2O4 — CID 95143353
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-oxo-2-(3-phenylpropylamino)acetate (PubChem CID 95143353) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-oxo-2-(3-phenylpropylamino)acetate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-oxo-2-(3-phenylpropylamino)acetate |
|---|---|
| PubChem CID | 95143353 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-oxo-2-(3-phenylpropylamino)acetate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O4/c1-3-11-18-15(20)13(2)23-17(22)16(21)19-12-7-10-14-8-5-4-6-9-14/h3-6,8-9,13H,1,7,10-12H2,2H3,(H,18,20)(H,19,21)/t13-/m1/s1 |
| InChIKey | WEVACBZHNNDOQM-CYBMUJFWSA-N |
| XLogP | 0.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|