C17H23N3O4 — CID 95148404
2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-ethyl-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 95148404) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-ethyl-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-ethyl-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 95148404 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[(4S)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-ethyl-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | CCN(Cc1ccc(OC)cc1)C(=O)C[C@H]1C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C17H23N3O4/c1-5-20(11-12-6-8-13(24-4)9-7-12)15(21)10-14-16(22)19(3)17(23)18(14)2/h6-9,14H,5,10-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | YISOZGLQEHBOIA-AWEZNQCLSA-N |
| XLogP | 1.33 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|