C24H29N3O4 — CID 95152601
[(1R)-1-(3-acetamidophenyl)ethyl] 4-[(4-acetylpiperazin-1-yl)methyl]benzoate (PubChem CID 95152601) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is [(1R)-1-(3-acetamidophenyl)ethyl] 4-[(4-acetylpiperazin-1-yl)methyl]benzoate.
| Compound Name | [(1R)-1-(3-acetamidophenyl)ethyl] 4-[(4-acetylpiperazin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 95152601 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [(1R)-1-(3-acetamidophenyl)ethyl] 4-[(4-acetylpiperazin-1-yl)methyl]benzoate |
| SMILES | CC(=O)Nc1cccc([C@@H](C)OC(=O)c2ccc(CN3CCN(C(C)=O)CC3)cc2)c1 |
| InChI | InChI=1S/C24H29N3O4/c1-17(22-5-4-6-23(15-22)25-18(2)28)31-24(30)21-9-7-20(8-10-21)16-26-11-13-27(14-12-26)19(3)29/h4-10,15,17H,11-14,16H2,1-3H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | ABHSYJXXLBSRNG-QGZVFWFLSA-N |
| XLogP | 3.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |