C16H26N4O2S — CID 95153320
(4R)-3-(3,3-dimethylbutanoyl)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 95153320) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is (4R)-3-(3,3-dimethylbutanoyl)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-(3,3-dimethylbutanoyl)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95153320 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (4R)-3-(3,3-dimethylbutanoyl)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1CSC[C@H]1C(=O)NCCCn1cccn1 |
| InChI | InChI=1S/C16H26N4O2S/c1-16(2,3)10-14(21)20-12-23-11-13(20)15(22)17-6-4-8-19-9-5-7-18-19/h5,7,9,13H,4,6,8,10-12H2,1-3H3,(H,17,22)/t13-/m0/s1 |
| InChIKey | JQTIDBQWYMQNRP-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|