C16H23NO6S — CID 95155386
dimethyl (2S)-2-[[4-[(2S)-butan-2-yl]phenyl]sulfonylamino]butanedioate (PubChem CID 95155386) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is dimethyl (2S)-2-[[4-[(2S)-butan-2-yl]phenyl]sulfonylamino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[4-[(2S)-butan-2-yl]phenyl]sulfonylamino]butanedioate |
|---|---|
| PubChem CID | 95155386 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | dimethyl (2S)-2-[[4-[(2S)-butan-2-yl]phenyl]sulfonylamino]butanedioate |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)N[C@@H](CC(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H23NO6S/c1-5-11(2)12-6-8-13(9-7-12)24(20,21)17-14(16(19)23-4)10-15(18)22-3/h6-9,11,14,17H,5,10H2,1-4H3/t11-,14-/m0/s1 |
| InChIKey | SZZQRMJXFZXJMB-FZMZJTMJSA-N |
| XLogP | 1.58 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |